C21H19FN4O3S3 — CID 4880569
2-(2-fluorophenyl)sulfonyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 4880569) has the molecular formula C21H19FN4O3S3 and a molecular weight of 490.61 g/mol. Its IUPAC name is 2-(2-fluorophenyl)sulfonyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | 2-(2-fluorophenyl)sulfonyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 4880569 |
| Molecular Formula | C21H19FN4O3S3 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | 2-(2-fluorophenyl)sulfonyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | C=CCSc1nnc(NC(=O)C2Cc3ccccc3CN2S(=O)(=O)c2ccccc2F)s1 |
| InChI | InChI=1S/C21H19FN4O3S3/c1-2-11-30-21-25-24-20(31-21)23-19(27)17-12-14-7-3-4-8-15(14)13-26(17)32(28,29)18-10-6-5-9-16(18)22/h2-10,17H,1,11-13H2,(H,23,24,27) |
| InChIKey | SJIXQVICCUATPC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|