C21H23N5OS — CID 4101336
N-(4-methylpiperazin-1-yl)-2-(4-phenylquinazolin-2-yl)sulfanylacetamide (PubChem CID 4101336) has the molecular formula C21H23N5OS and a molecular weight of 393.52 g/mol. Its IUPAC name is N-(4-methylpiperazin-1-yl)-2-(4-phenylquinazolin-2-yl)sulfanylacetamide.
| Compound Name | N-(4-methylpiperazin-1-yl)-2-(4-phenylquinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 4101336 |
| Molecular Formula | C21H23N5OS |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | N-(4-methylpiperazin-1-yl)-2-(4-phenylquinazolin-2-yl)sulfanylacetamide |
| SMILES | CN1CCN(NC(=O)CSc2nc(-c3ccccc3)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C21H23N5OS/c1-25-11-13-26(14-12-25)24-19(27)15-28-21-22-18-10-6-5-9-17(18)20(23-21)16-7-3-2-4-8-16/h2-10H,11-15H2,1H3,(H,24,27) |
| InChIKey | HTUSJSXZKDRLJD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |