C18H15N3O3S — CID 44723920
2-[2-(2-methylanilino)-2-oxoethyl]sulfanylquinazoline-4-carboxylic acid (PubChem CID 44723920) has the molecular formula C18H15N3O3S and a molecular weight of 353.40 g/mol. Its IUPAC name is 2-[2-(2-methylanilino)-2-oxoethyl]sulfanylquinazoline-4-carboxylic acid.
| Compound Name | 2-[2-(2-methylanilino)-2-oxoethyl]sulfanylquinazoline-4-carboxylic acid |
|---|---|
| PubChem CID | 44723920 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 2-[2-(2-methylanilino)-2-oxoethyl]sulfanylquinazoline-4-carboxylic acid |
| SMILES | Cc1ccccc1NC(=O)CSc1nc(C(=O)O)c2ccccc2n1 |
| InChI | InChI=1S/C18H15N3O3S/c1-11-6-2-4-8-13(11)19-15(22)10-25-18-20-14-9-5-3-7-12(14)16(21-18)17(23)24/h2-9H,10H2,1H3,(H,19,22)(H,23,24) |
| InChIKey | ZOPCCWNGWNSREG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |