C15H20N2O2S — CID 41024058
(5S)-5-(2,4-dimethylanilino)-3-(2-methylpropyl)-1,3-thiazolidine-2,4-dione (PubChem CID 41024058) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is (5S)-5-(2,4-dimethylanilino)-3-(2-methylpropyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5S)-5-(2,4-dimethylanilino)-3-(2-methylpropyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 41024058 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | (5S)-5-(2,4-dimethylanilino)-3-(2-methylpropyl)-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(N[C@H]2SC(=O)N(CC(C)C)C2=O)c(C)c1 |
| InChI | InChI=1S/C15H20N2O2S/c1-9(2)8-17-14(18)13(20-15(17)19)16-12-6-5-10(3)7-11(12)4/h5-7,9,13,16H,8H2,1-4H3/t13-/m0/s1 |
| InChIKey | RPLBOTMRBQJGIZ-ZDUSSCGKSA-N |
| XLogP | 3.39 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|