C13H22N4O3 — CID 4103535
N-[1-(dipropylamino)-3-hydroxy-1-oxopropan-2-yl]-1H-imidazole-5-carboxamide (PubChem CID 4103535) has the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is N-[1-(dipropylamino)-3-hydroxy-1-oxopropan-2-yl]-1H-imidazole-5-carboxamide.
| Compound Name | N-[1-(dipropylamino)-3-hydroxy-1-oxopropan-2-yl]-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 4103535 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | N-[1-(dipropylamino)-3-hydroxy-1-oxopropan-2-yl]-1H-imidazole-5-carboxamide |
| SMILES | CCCN(CCC)C(=O)C(CO)NC(=O)c1cnc[nH]1 |
| InChI | InChI=1S/C13H22N4O3/c1-3-5-17(6-4-2)13(20)11(8-18)16-12(19)10-7-14-9-15-10/h7,9,11,18H,3-6,8H2,1-2H3,(H,14,15)(H,16,19) |
| InChIKey | ZOFYTGMTVVNVJB-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |