C24H29BrN2O6S — CID 4107437
[2-(cycloheptylamino)-2-oxoethyl] 4-[(5-bromo-2-ethoxyphenyl)sulfonylamino]benzoate (PubChem CID 4107437) has the molecular formula C24H29BrN2O6S and a molecular weight of 553.48 g/mol. Its IUPAC name is [2-(cycloheptylamino)-2-oxoethyl] 4-[(5-bromo-2-ethoxyphenyl)sulfonylamino]benzoate.
| Compound Name | [2-(cycloheptylamino)-2-oxoethyl] 4-[(5-bromo-2-ethoxyphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 4107437 |
| Molecular Formula | C24H29BrN2O6S |
| Molecular Weight | 553.48 g/mol |
| Exact Mass | 552.09 |
| IUPAC Name | [2-(cycloheptylamino)-2-oxoethyl] 4-[(5-bromo-2-ethoxyphenyl)sulfonylamino]benzoate |
| SMILES | CCOc1ccc(Br)cc1S(=O)(=O)Nc1ccc(C(=O)OCC(=O)NC2CCCCCC2)cc1 |
| InChI | InChI=1S/C24H29BrN2O6S/c1-2-32-21-14-11-18(25)15-22(21)34(30,31)27-20-12-9-17(10-13-20)24(29)33-16-23(28)26-19-7-5-3-4-6-8-19/h9-15,19,27H,2-8,16H2,1H3,(H,26,28) |
| InChIKey | XPBZXGBBPNRCFE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |