C22H28ClN3O5S — CID 41082219
[(2S)-1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] (2R)-2-[(3-chlorophenyl)sulfonylamino]-3-methylbutanoate (PubChem CID 41082219) has the molecular formula C22H28ClN3O5S and a molecular weight of 482.00 g/mol. Its IUPAC name is [(2S)-1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] (2R)-2-[(3-chlorophenyl)sulfonylamino]-3-methylbutanoate.
| Compound Name | [(2S)-1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] (2R)-2-[(3-chlorophenyl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 41082219 |
| Molecular Formula | C22H28ClN3O5S |
| Molecular Weight | 482.00 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | [(2S)-1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] (2R)-2-[(3-chlorophenyl)sulfonylamino]-3-methylbutanoate |
| SMILES | CC(C)[C@@H](NS(=O)(=O)c1cccc(Cl)c1)C(=O)O[C@@H](C)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C22H28ClN3O5S/c1-14(2)20(25-32(29,30)19-8-6-7-16(23)13-19)22(28)31-15(3)21(27)24-17-9-11-18(12-10-17)26(4)5/h6-15,20,25H,1-5H3,(H,24,27)/t15-,20+/m0/s1 |
| InChIKey | YCZZEDJGCYCMDH-MGPUTAFESA-N |
| XLogP | 3.28 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.00 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|