C24H21ClN4OS — CID 4108526
N-[2-(4-chlorophenyl)ethyl]-4-[[(2-sulfanylidene-1H-quinazolin-4-yl)amino]methyl]benzamide (PubChem CID 4108526) has the molecular formula C24H21ClN4OS and a molecular weight of 448.98 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-4-[[(2-sulfanylidene-1H-quinazolin-4-yl)amino]methyl]benzamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-4-[[(2-sulfanylidene-1H-quinazolin-4-yl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 4108526 |
| Molecular Formula | C24H21ClN4OS |
| Molecular Weight | 448.98 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-4-[[(2-sulfanylidene-1H-quinazolin-4-yl)amino]methyl]benzamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)c1ccc(CNc2nc(=S)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C24H21ClN4OS/c25-19-11-7-16(8-12-19)13-14-26-23(30)18-9-5-17(6-10-18)15-27-22-20-3-1-2-4-21(20)28-24(31)29-22/h1-12H,13-15H2,(H,26,30)(H2,27,28,29,31) |
| InChIKey | SYQMJBRFJZCZSJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.98 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|