C21H22ClN3OS2 — CID 41085989
1-[4-(4-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]-4-phenylsulfanylbutan-1-one (PubChem CID 41085989) has the molecular formula C21H22ClN3OS2 and a molecular weight of 432.01 g/mol. Its IUPAC name is 1-[4-(4-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]-4-phenylsulfanylbutan-1-one.
| Compound Name | 1-[4-(4-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]-4-phenylsulfanylbutan-1-one |
|---|---|
| PubChem CID | 41085989 |
| Molecular Formula | C21H22ClN3OS2 |
| Molecular Weight | 432.01 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 1-[4-(4-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]-4-phenylsulfanylbutan-1-one |
| SMILES | O=C(CCCSc1ccccc1)N1CCN(c2nc3c(Cl)cccc3s2)CC1 |
| InChI | InChI=1S/C21H22ClN3OS2/c22-17-8-4-9-18-20(17)23-21(28-18)25-13-11-24(12-14-25)19(26)10-5-15-27-16-6-2-1-3-7-16/h1-4,6-9H,5,10-15H2 |
| InChIKey | ILHHTIAPWMRVGI-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.01 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|