C23H26ClN3OS2 — CID 41086324
1-[4-(7-chloro-4-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-4-(4-methylphenyl)sulfanylbutan-1-one (PubChem CID 41086324) has the molecular formula C23H26ClN3OS2 and a molecular weight of 460.07 g/mol. Its IUPAC name is 1-[4-(7-chloro-4-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-4-(4-methylphenyl)sulfanylbutan-1-one.
| Compound Name | 1-[4-(7-chloro-4-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-4-(4-methylphenyl)sulfanylbutan-1-one |
|---|---|
| PubChem CID | 41086324 |
| Molecular Formula | C23H26ClN3OS2 |
| Molecular Weight | 460.07 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 1-[4-(7-chloro-4-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-4-(4-methylphenyl)sulfanylbutan-1-one |
| SMILES | Cc1ccc(SCCCC(=O)N2CCN(c3nc4c(C)ccc(Cl)c4s3)CC2)cc1 |
| InChI | InChI=1S/C23H26ClN3OS2/c1-16-5-8-18(9-6-16)29-15-3-4-20(28)26-11-13-27(14-12-26)23-25-21-17(2)7-10-19(24)22(21)30-23/h5-10H,3-4,11-15H2,1-2H3 |
| InChIKey | RYSCXTZSJCUTIL-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.07 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|