C22H24ClN3OS2 — CID 41086318
1-[4-(4-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]-4-(4-methylphenyl)sulfanylbutan-1-one (PubChem CID 41086318) has the molecular formula C22H24ClN3OS2 and a molecular weight of 446.04 g/mol. Its IUPAC name is 1-[4-(4-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]-4-(4-methylphenyl)sulfanylbutan-1-one.
| Compound Name | 1-[4-(4-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]-4-(4-methylphenyl)sulfanylbutan-1-one |
|---|---|
| PubChem CID | 41086318 |
| Molecular Formula | C22H24ClN3OS2 |
| Molecular Weight | 446.04 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 1-[4-(4-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]-4-(4-methylphenyl)sulfanylbutan-1-one |
| SMILES | Cc1ccc(SCCCC(=O)N2CCN(c3nc4c(Cl)cccc4s3)CC2)cc1 |
| InChI | InChI=1S/C22H24ClN3OS2/c1-16-7-9-17(10-8-16)28-15-3-6-20(27)25-11-13-26(14-12-25)22-24-21-18(23)4-2-5-19(21)29-22/h2,4-5,7-10H,3,6,11-15H2,1H3 |
| InChIKey | WEDIMENOKBTXMD-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.04 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|