C24H29N3OS2 — CID 41086316
1-[4-(4-ethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-4-(4-methylphenyl)sulfanylbutan-1-one (PubChem CID 41086316) has the molecular formula C24H29N3OS2 and a molecular weight of 439.65 g/mol. Its IUPAC name is 1-[4-(4-ethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-4-(4-methylphenyl)sulfanylbutan-1-one.
| Compound Name | 1-[4-(4-ethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-4-(4-methylphenyl)sulfanylbutan-1-one |
|---|---|
| PubChem CID | 41086316 |
| Molecular Formula | C24H29N3OS2 |
| Molecular Weight | 439.65 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 1-[4-(4-ethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-4-(4-methylphenyl)sulfanylbutan-1-one |
| SMILES | CCc1cccc2sc(N3CCN(C(=O)CCCSc4ccc(C)cc4)CC3)nc12 |
| InChI | InChI=1S/C24H29N3OS2/c1-3-19-6-4-7-21-23(19)25-24(30-21)27-15-13-26(14-16-27)22(28)8-5-17-29-20-11-9-18(2)10-12-20/h4,6-7,9-12H,3,5,8,13-17H2,1-2H3 |
| InChIKey | WAYVKUWUDNWYHS-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.65 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|