C20H16ClNO7 — CID 41092225
dimethyl 2-[[(3R)-6-chloro-1-oxo-3,4-dihydroisochromene-3-carbonyl]amino]benzene-1,4-dicarboxylate (PubChem CID 41092225) has the molecular formula C20H16ClNO7 and a molecular weight of 417.80 g/mol. Its IUPAC name is dimethyl 2-[[(3R)-6-chloro-1-oxo-3,4-dihydroisochromene-3-carbonyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[(3R)-6-chloro-1-oxo-3,4-dihydroisochromene-3-carbonyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 41092225 |
| Molecular Formula | C20H16ClNO7 |
| Molecular Weight | 417.80 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | dimethyl 2-[[(3R)-6-chloro-1-oxo-3,4-dihydroisochromene-3-carbonyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)[C@H]2Cc3cc(Cl)ccc3C(=O)O2)c1 |
| InChI | InChI=1S/C20H16ClNO7/c1-27-18(24)10-3-5-14(19(25)28-2)15(8-10)22-17(23)16-9-11-7-12(21)4-6-13(11)20(26)29-16/h3-8,16H,9H2,1-2H3,(H,22,23)/t16-/m1/s1 |
| InChIKey | LYQKGZNSGRWPMW-MRXNPFEDSA-N |
| XLogP | 2.63 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.80 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|