C21H18ClNO7 — CID 42107471
dimethyl 2-[[(3S)-7-chloro-3-methyl-1-oxo-4H-isochromene-3-carbonyl]amino]benzene-1,4-dicarboxylate (PubChem CID 42107471) has the molecular formula C21H18ClNO7 and a molecular weight of 431.83 g/mol. Its IUPAC name is dimethyl 2-[[(3S)-7-chloro-3-methyl-1-oxo-4H-isochromene-3-carbonyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[(3S)-7-chloro-3-methyl-1-oxo-4H-isochromene-3-carbonyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 42107471 |
| Molecular Formula | C21H18ClNO7 |
| Molecular Weight | 431.83 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | dimethyl 2-[[(3S)-7-chloro-3-methyl-1-oxo-4H-isochromene-3-carbonyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)[C@]2(C)Cc3ccc(Cl)cc3C(=O)O2)c1 |
| InChI | InChI=1S/C21H18ClNO7/c1-21(10-12-4-6-13(22)9-15(12)19(26)30-21)20(27)23-16-8-11(17(24)28-2)5-7-14(16)18(25)29-3/h4-9H,10H2,1-3H3,(H,23,27)/t21-/m0/s1 |
| InChIKey | HEVJDUXRXBWBGJ-NRFANRHFSA-N |
| XLogP | 3.02 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.83 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|