C23H22N4O2S — CID 41142176
11,13-dimethyl-5-[(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one (PubChem CID 41142176) has the molecular formula C23H22N4O2S and a molecular weight of 418.52 g/mol. Its IUPAC name is 11,13-dimethyl-5-[(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one.
| Compound Name | 11,13-dimethyl-5-[(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
|---|---|
| PubChem CID | 41142176 |
| Molecular Formula | C23H22N4O2S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 11,13-dimethyl-5-[(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| SMILES | Cc1cc(C)c2c(n1)sc1c(=O)n([C@H](C(=O)N3CCCC3)c3ccccc3)cnc12 |
| InChI | InChI=1S/C23H22N4O2S/c1-14-12-15(2)25-21-17(14)18-20(30-21)23(29)27(13-24-18)19(16-8-4-3-5-9-16)22(28)26-10-6-7-11-26/h3-5,8-9,12-13,19H,6-7,10-11H2,1-2H3/t19-/m0/s1 |
| InChIKey | QSIJAVIZJKIRBP-IBGZPJMESA-N |
| XLogP | 3.83 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |