C26H22N4O2S — CID 46362674
4-(11,13-dimethyl-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-yl)-N-(3,4-dimethylphenyl)benzamide (PubChem CID 46362674) has the molecular formula C26H22N4O2S and a molecular weight of 454.56 g/mol. Its IUPAC name is 4-(11,13-dimethyl-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-yl)-N-(3,4-dimethylphenyl)benzamide.
| Compound Name | 4-(11,13-dimethyl-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-yl)-N-(3,4-dimethylphenyl)benzamide |
|---|---|
| PubChem CID | 46362674 |
| Molecular Formula | C26H22N4O2S |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 4-(11,13-dimethyl-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-5-yl)-N-(3,4-dimethylphenyl)benzamide |
| SMILES | Cc1cc(C)c2c(n1)sc1c(=O)n(-c3ccc(C(=O)Nc4ccc(C)c(C)c4)cc3)cnc12 |
| InChI | InChI=1S/C26H22N4O2S/c1-14-5-8-19(12-15(14)2)29-24(31)18-6-9-20(10-7-18)30-13-27-22-21-16(3)11-17(4)28-25(21)33-23(22)26(30)32/h5-13H,1-4H3,(H,29,31) |
| InChIKey | DEFUBXGSZSAWSR-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |