C22H22N2O5S — CID 4114838
ethyl 4-[3-[(2-methoxyphenyl)methyl]-4-oxoquinazolin-2-yl]sulfanyl-3-oxobutanoate (PubChem CID 4114838) has the molecular formula C22H22N2O5S and a molecular weight of 426.49 g/mol. Its IUPAC name is ethyl 4-[3-[(2-methoxyphenyl)methyl]-4-oxoquinazolin-2-yl]sulfanyl-3-oxobutanoate.
| Compound Name | ethyl 4-[3-[(2-methoxyphenyl)methyl]-4-oxoquinazolin-2-yl]sulfanyl-3-oxobutanoate |
|---|---|
| PubChem CID | 4114838 |
| Molecular Formula | C22H22N2O5S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | ethyl 4-[3-[(2-methoxyphenyl)methyl]-4-oxoquinazolin-2-yl]sulfanyl-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)CSc1nc2ccccc2c(=O)n1Cc1ccccc1OC |
| InChI | InChI=1S/C22H22N2O5S/c1-3-29-20(26)12-16(25)14-30-22-23-18-10-6-5-9-17(18)21(27)24(22)13-15-8-4-7-11-19(15)28-2/h4-11H,3,12-14H2,1-2H3 |
| InChIKey | ZUVMRJQYHBWJRU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|