C21H17Cl2N3OS — CID 41177190
(8S)-3-(3-chloro-2-methylphenyl)-8-(2-chlorophenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile (PubChem CID 41177190) has the molecular formula C21H17Cl2N3OS and a molecular weight of 430.36 g/mol. Its IUPAC name is (8S)-3-(3-chloro-2-methylphenyl)-8-(2-chlorophenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile.
| Compound Name | (8S)-3-(3-chloro-2-methylphenyl)-8-(2-chlorophenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
|---|---|
| PubChem CID | 41177190 |
| Molecular Formula | C21H17Cl2N3OS |
| Molecular Weight | 430.36 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | (8S)-3-(3-chloro-2-methylphenyl)-8-(2-chlorophenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
| SMILES | Cc1c(Cl)cccc1N1CSC2=C(C#N)[C@@H](c3ccccc3Cl)CC(=O)N2C1 |
| InChI | InChI=1S/C21H17Cl2N3OS/c1-13-17(22)7-4-8-19(13)25-11-26-20(27)9-15(14-5-2-3-6-18(14)23)16(10-24)21(26)28-12-25/h2-8,15H,9,11-12H2,1H3/t15-/m1/s1 |
| InChIKey | TXLSQKNWOCZGOY-OAHLLOKOSA-N |
| XLogP | 5.52 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.36 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |