C19H17N3OS2 — CID 7227545
(8R)-3-(2-methylphenyl)-6-oxo-8-thiophen-2-yl-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile (PubChem CID 7227545) has the molecular formula C19H17N3OS2 and a molecular weight of 367.50 g/mol. Its IUPAC name is (8R)-3-(2-methylphenyl)-6-oxo-8-thiophen-2-yl-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile.
| Compound Name | (8R)-3-(2-methylphenyl)-6-oxo-8-thiophen-2-yl-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
|---|---|
| PubChem CID | 7227545 |
| Molecular Formula | C19H17N3OS2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | (8R)-3-(2-methylphenyl)-6-oxo-8-thiophen-2-yl-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
| SMILES | Cc1ccccc1N1CSC2=C(C#N)[C@H](c3cccs3)CC(=O)N2C1 |
| InChI | InChI=1S/C19H17N3OS2/c1-13-5-2-3-6-16(13)21-11-22-18(23)9-14(17-7-4-8-24-17)15(10-20)19(22)25-12-21/h2-8,14H,9,11-12H2,1H3/t14-/m1/s1 |
| InChIKey | ZGNMIDNAMUBRAN-CQSZACIVSA-N |
| XLogP | 4.28 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |