C21H16Cl3N3OS — CID 42486211
(8S)-3-(3-chloro-2-methylphenyl)-8-(2,6-dichlorophenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile (PubChem CID 42486211) has the molecular formula C21H16Cl3N3OS and a molecular weight of 464.81 g/mol. Its IUPAC name is (8S)-3-(3-chloro-2-methylphenyl)-8-(2,6-dichlorophenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile.
| Compound Name | (8S)-3-(3-chloro-2-methylphenyl)-8-(2,6-dichlorophenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
|---|---|
| PubChem CID | 42486211 |
| Molecular Formula | C21H16Cl3N3OS |
| Molecular Weight | 464.81 g/mol |
| Exact Mass | 463.01 |
| IUPAC Name | (8S)-3-(3-chloro-2-methylphenyl)-8-(2,6-dichlorophenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
| SMILES | Cc1c(Cl)cccc1N1CSC2=C(C#N)[C@@H](c3c(Cl)cccc3Cl)CC(=O)N2C1 |
| InChI | InChI=1S/C21H16Cl3N3OS/c1-12-15(22)4-3-7-18(12)26-10-27-19(28)8-13(14(9-25)21(27)29-11-26)20-16(23)5-2-6-17(20)24/h2-7,13H,8,10-11H2,1H3/t13-/m0/s1 |
| InChIKey | PYMRRUAIOQUMRJ-ZDUSSCGKSA-N |
| XLogP | 6.17 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.81 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |