C18H17N3OS2 — CID 144586980
3-[(3E)-hexa-1,3,5-trien-3-yl]-6-oxo-8-thiophen-2-yl-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile (PubChem CID 144586980) has the molecular formula C18H17N3OS2 and a molecular weight of 355.49 g/mol. Its IUPAC name is 3-[(3E)-hexa-1,3,5-trien-3-yl]-6-oxo-8-thiophen-2-yl-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile.
| Compound Name | 3-[(3E)-hexa-1,3,5-trien-3-yl]-6-oxo-8-thiophen-2-yl-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
|---|---|
| PubChem CID | 144586980 |
| Molecular Formula | C18H17N3OS2 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 3-[(3E)-hexa-1,3,5-trien-3-yl]-6-oxo-8-thiophen-2-yl-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
| SMILES | C=C/C=C(\C=C)N1CSC2=C(C#N)C(c3cccs3)CC(=O)N2C1 |
| InChI | InChI=1S/C18H17N3OS2/c1-3-6-13(4-2)20-11-21-17(22)9-14(16-7-5-8-23-16)15(10-19)18(21)24-12-20/h3-8,14H,1-2,9,11-12H2/b13-6+ |
| InChIKey | YTVYATUAROJWRG-AWNIVKPZSA-N |
| XLogP | 4.02 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|