C18H15N5O2 — CID 4117844
2-amino-4-cyclopropyl-6-(3-nitrophenyl)cyclohex-2-ene-1,1,3-tricarbonitrile (PubChem CID 4117844) has the molecular formula C18H15N5O2 and a molecular weight of 333.35 g/mol. Its IUPAC name is 2-amino-4-cyclopropyl-6-(3-nitrophenyl)cyclohex-2-ene-1,1,3-tricarbonitrile.
| Compound Name | 2-amino-4-cyclopropyl-6-(3-nitrophenyl)cyclohex-2-ene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 4117844 |
| Molecular Formula | C18H15N5O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 2-amino-4-cyclopropyl-6-(3-nitrophenyl)cyclohex-2-ene-1,1,3-tricarbonitrile |
| SMILES | N#CC1=C(N)C(C#N)(C#N)C(c2cccc([N+](=O)[O-])c2)CC1C1CC1 |
| InChI | InChI=1S/C18H15N5O2/c19-8-15-14(11-4-5-11)7-16(18(9-20,10-21)17(15)22)12-2-1-3-13(6-12)23(24)25/h1-3,6,11,14,16H,4-5,7,22H2 |
| InChIKey | CQTYXSGRDPSVHK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 140.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|