C14H14N2O5 — CID 141202191
(1S,4S,5S,6R)-5-nitro-6-(3-nitrophenyl)bicyclo[2.2.2]octan-2-one (PubChem CID 141202191) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is (1S,4S,5S,6R)-5-nitro-6-(3-nitrophenyl)bicyclo[2.2.2]octan-2-one.
| Compound Name | (1S,4S,5S,6R)-5-nitro-6-(3-nitrophenyl)bicyclo[2.2.2]octan-2-one |
|---|---|
| PubChem CID | 141202191 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (1S,4S,5S,6R)-5-nitro-6-(3-nitrophenyl)bicyclo[2.2.2]octan-2-one |
| SMILES | O=C1C[C@@H]2CC[C@H]1[C@H](c1cccc([N+](=O)[O-])c1)[C@H]2[N+](=O)[O-] |
| InChI | InChI=1S/C14H14N2O5/c17-12-7-9-4-5-11(12)13(14(9)16(20)21)8-2-1-3-10(6-8)15(18)19/h1-3,6,9,11,13-14H,4-5,7H2/t9-,11+,13-,14-/m0/s1 |
| InChIKey | UMDFQXHLCORGLW-HYKPAMGXSA-N |
| XLogP | 2.32 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|