C29H26N2O8 — CID 88924777
(3R,4S,5R)-5-(4-methoxyphenyl)-2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]-4-nitro-3-(3-nitrophenyl)cyclohexan-1-one (PubChem CID 88924777) has the molecular formula C29H26N2O8 and a molecular weight of 530.53 g/mol. Its IUPAC name is (3R,4S,5R)-5-(4-methoxyphenyl)-2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]-4-nitro-3-(3-nitrophenyl)cyclohexan-1-one.
| Compound Name | (3R,4S,5R)-5-(4-methoxyphenyl)-2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]-4-nitro-3-(3-nitrophenyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 88924777 |
| Molecular Formula | C29H26N2O8 |
| Molecular Weight | 530.53 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | (3R,4S,5R)-5-(4-methoxyphenyl)-2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]-4-nitro-3-(3-nitrophenyl)cyclohexan-1-one |
| SMILES | COc1ccc(/C=C/C(=O)C2C(=O)C[C@H](c3ccc(OC)cc3)[C@H]([N+](=O)[O-])[C@H]2c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C29H26N2O8/c1-38-22-11-6-18(7-12-22)8-15-25(32)28-26(33)17-24(19-9-13-23(39-2)14-10-19)29(31(36)37)27(28)20-4-3-5-21(16-20)30(34)35/h3-16,24,27-29H,17H2,1-2H3/b15-8+/t24-,27+,28?,29+/m1/s1 |
| InChIKey | IHRNDQHKSBXZTJ-KYFQUBLLSA-N |
| XLogP | 5.00 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|