C30H27NO8 — CID 53252697
(3R,4S,5R)-3-(1,3-benzodioxol-5-yl)-5-(4-methoxyphenyl)-2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]-4-nitrocyclohexan-1-one (PubChem CID 53252697) has the molecular formula C30H27NO8 and a molecular weight of 529.55 g/mol. Its IUPAC name is (3R,4S,5R)-3-(1,3-benzodioxol-5-yl)-5-(4-methoxyphenyl)-2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]-4-nitrocyclohexan-1-one.
| Compound Name | (3R,4S,5R)-3-(1,3-benzodioxol-5-yl)-5-(4-methoxyphenyl)-2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]-4-nitrocyclohexan-1-one |
|---|---|
| PubChem CID | 53252697 |
| Molecular Formula | C30H27NO8 |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | (3R,4S,5R)-3-(1,3-benzodioxol-5-yl)-5-(4-methoxyphenyl)-2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]-4-nitrocyclohexan-1-one |
| SMILES | COc1ccc(/C=C/C(=O)C2C(=O)C[C@H](c3ccc(OC)cc3)[C@H]([N+](=O)[O-])[C@H]2c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C30H27NO8/c1-36-21-9-3-18(4-10-21)5-13-24(32)29-25(33)16-23(19-6-11-22(37-2)12-7-19)30(31(34)35)28(29)20-8-14-26-27(15-20)39-17-38-26/h3-15,23,28-30H,16-17H2,1-2H3/b13-5+/t23-,28+,29?,30+/m1/s1 |
| InChIKey | OHPGEWAFOIRVPU-KPAOSYIDSA-N |
| XLogP | 4.82 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|