C19H25NO6 — CID 11199282
tert-butyl 2-[(1R,2S,3S)-3-(1,3-benzodioxol-5-yl)-2-nitrocyclohexyl]acetate (PubChem CID 11199282) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is tert-butyl 2-[(1R,2S,3S)-3-(1,3-benzodioxol-5-yl)-2-nitrocyclohexyl]acetate.
| Compound Name | tert-butyl 2-[(1R,2S,3S)-3-(1,3-benzodioxol-5-yl)-2-nitrocyclohexyl]acetate |
|---|---|
| PubChem CID | 11199282 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | tert-butyl 2-[(1R,2S,3S)-3-(1,3-benzodioxol-5-yl)-2-nitrocyclohexyl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@H]1CCC[C@@H](c2ccc3c(c2)OCO3)[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C19H25NO6/c1-19(2,3)26-17(21)10-13-5-4-6-14(18(13)20(22)23)12-7-8-15-16(9-12)25-11-24-15/h7-9,13-14,18H,4-6,10-11H2,1-3H3/t13-,14+,18+/m1/s1 |
| InChIKey | FFMAHUJYMQJIFD-GLJUWKHASA-N |
| XLogP | 3.68 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|