C20H25NO8 — CID 559268
9-(1,3-benzodioxol-5-yl)-8-nitro-7-(oxan-2-yloxy)-1,4-dioxaspiro[4.5]decane (PubChem CID 559268) has the molecular formula C20H25NO8 and a molecular weight of 407.42 g/mol. Its IUPAC name is 9-(1,3-benzodioxol-5-yl)-8-nitro-7-(oxan-2-yloxy)-1,4-dioxaspiro[4.5]decane.
| Compound Name | 9-(1,3-benzodioxol-5-yl)-8-nitro-7-(oxan-2-yloxy)-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 559268 |
| Molecular Formula | C20H25NO8 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 9-(1,3-benzodioxol-5-yl)-8-nitro-7-(oxan-2-yloxy)-1,4-dioxaspiro[4.5]decane |
| SMILES | O=[N+]([O-])C1C(OC2CCCCO2)CC2(CC1c1ccc3c(c1)OCO3)OCCO2 |
| InChI | InChI=1S/C20H25NO8/c22-21(23)19-14(13-4-5-15-16(9-13)26-12-25-15)10-20(27-7-8-28-20)11-17(19)29-18-3-1-2-6-24-18/h4-5,9,14,17-19H,1-3,6-8,10-12H2 |
| InChIKey | QKFLCQHUSMQBKJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 98.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|