C15H17NO5 — CID 11415080
cis-(2S,6R)-2-(1,3-benzodioxol-5-yl)-6-(2-nitroethyl)cyclohexan-1-one (PubChem CID 11415080) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is cis-(2S,6R)-2-(1,3-benzodioxol-5-yl)-6-(2-nitroethyl)cyclohexan-1-one.
| Compound Name | cis-(2S,6R)-2-(1,3-benzodioxol-5-yl)-6-(2-nitroethyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 11415080 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | cis-(2S,6R)-2-(1,3-benzodioxol-5-yl)-6-(2-nitroethyl)cyclohexan-1-one |
| SMILES | O=C1[C@@H](CC[N+](=O)[O-])CCC[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H17NO5/c17-15-10(6-7-16(18)19)2-1-3-12(15)11-4-5-13-14(8-11)21-9-20-13/h4-5,8,10,12H,1-3,6-7,9H2/t10-,12+/m1/s1 |
| InChIKey | ARNSIORLTBGXPY-PWSUYJOCSA-N |
| XLogP | 2.53 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|