C15H17NO2 — CID 10466953
(3aR,7R)-7-(1,3-benzodioxol-5-yl)-3,3a,4,5,6,7-hexahydro-2H-indole (PubChem CID 10466953) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is (3aR,7R)-7-(1,3-benzodioxol-5-yl)-3,3a,4,5,6,7-hexahydro-2H-indole.
| Compound Name | (3aR,7R)-7-(1,3-benzodioxol-5-yl)-3,3a,4,5,6,7-hexahydro-2H-indole |
|---|---|
| PubChem CID | 10466953 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | (3aR,7R)-7-(1,3-benzodioxol-5-yl)-3,3a,4,5,6,7-hexahydro-2H-indole |
| SMILES | c1cc2c(cc1[C@H]1CCC[C@@H]3CCN=C31)OCO2 |
| InChI | InChI=1S/C15H17NO2/c1-2-10-6-7-16-15(10)12(3-1)11-4-5-13-14(8-11)18-9-17-13/h4-5,8,10,12H,1-3,6-7,9H2/t10-,12-/m1/s1 |
| InChIKey | RYBUWDNMHKKQLX-ZYHUDNBSSA-N |
| XLogP | 3.14 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |