C20H15Br2N3O — CID 4117995
2-[(5,6-dibromo-1-ethylbenzimidazol-2-yl)iminomethyl]naphthalen-1-ol (PubChem CID 4117995) has the molecular formula C20H15Br2N3O and a molecular weight of 473.17 g/mol. Its IUPAC name is 2-[(5,6-dibromo-1-ethylbenzimidazol-2-yl)iminomethyl]naphthalen-1-ol.
| Compound Name | 2-[(5,6-dibromo-1-ethylbenzimidazol-2-yl)iminomethyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 4117995 |
| Molecular Formula | C20H15Br2N3O |
| Molecular Weight | 473.17 g/mol |
| Exact Mass | 470.96 |
| IUPAC Name | 2-[(5,6-dibromo-1-ethylbenzimidazol-2-yl)iminomethyl]naphthalen-1-ol |
| SMILES | CCn1c(N=Cc2ccc3ccccc3c2O)nc2cc(Br)c(Br)cc21 |
| InChI | InChI=1S/C20H15Br2N3O/c1-2-25-18-10-16(22)15(21)9-17(18)24-20(25)23-11-13-8-7-12-5-3-4-6-14(12)19(13)26/h3-11,26H,2H2,1H3 |
| InChIKey | SBHIKISGRSCZEW-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.17 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|