C18H26N4O5S2 — CID 4118030
4-[4-(2-cyanoethyl)piperazin-1-yl]sulfonyl-N-(oxolan-2-ylmethyl)benzenesulfonamide (PubChem CID 4118030) has the molecular formula C18H26N4O5S2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 4-[4-(2-cyanoethyl)piperazin-1-yl]sulfonyl-N-(oxolan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-[4-(2-cyanoethyl)piperazin-1-yl]sulfonyl-N-(oxolan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 4118030 |
| Molecular Formula | C18H26N4O5S2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 4-[4-(2-cyanoethyl)piperazin-1-yl]sulfonyl-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| SMILES | N#CCCN1CCN(S(=O)(=O)c2ccc(S(=O)(=O)NCC3CCCO3)cc2)CC1 |
| InChI | InChI=1S/C18H26N4O5S2/c19-8-2-9-21-10-12-22(13-11-21)29(25,26)18-6-4-17(5-7-18)28(23,24)20-15-16-3-1-14-27-16/h4-7,16,20H,1-3,9-15H2 |
| InChIKey | AXODPAQQLAXSFF-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |