C16H19N3O5S — CID 17161249
methyl (E)-2-cyano-3-[4-(oxolan-2-ylmethylsulfamoyl)anilino]prop-2-enoate (PubChem CID 17161249) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is methyl (E)-2-cyano-3-[4-(oxolan-2-ylmethylsulfamoyl)anilino]prop-2-enoate.
| Compound Name | methyl (E)-2-cyano-3-[4-(oxolan-2-ylmethylsulfamoyl)anilino]prop-2-enoate |
|---|---|
| PubChem CID | 17161249 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | methyl (E)-2-cyano-3-[4-(oxolan-2-ylmethylsulfamoyl)anilino]prop-2-enoate |
| SMILES | COC(=O)/C(C#N)=C/Nc1ccc(S(=O)(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C16H19N3O5S/c1-23-16(20)12(9-17)10-18-13-4-6-15(7-5-13)25(21,22)19-11-14-3-2-8-24-14/h4-7,10,14,18-19H,2-3,8,11H2,1H3/b12-10+ |
| InChIKey | XFGCJTUXOMLVRS-ZRDIBKRKSA-N |
| XLogP | 1.14 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|