C25H33N3O2 — CID 41200367
4-benzamido-N-[(1R)-1-(4-ethylphenyl)-2-methylpropyl]piperidine-1-carboxamide (PubChem CID 41200367) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 4-benzamido-N-[(1R)-1-(4-ethylphenyl)-2-methylpropyl]piperidine-1-carboxamide.
| Compound Name | 4-benzamido-N-[(1R)-1-(4-ethylphenyl)-2-methylpropyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 41200367 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 4-benzamido-N-[(1R)-1-(4-ethylphenyl)-2-methylpropyl]piperidine-1-carboxamide |
| SMILES | CCc1ccc([C@H](NC(=O)N2CCC(NC(=O)c3ccccc3)CC2)C(C)C)cc1 |
| InChI | InChI=1S/C25H33N3O2/c1-4-19-10-12-20(13-11-19)23(18(2)3)27-25(30)28-16-14-22(15-17-28)26-24(29)21-8-6-5-7-9-21/h5-13,18,22-23H,4,14-17H2,1-3H3,(H,26,29)(H,27,30)/t23-/m1/s1 |
| InChIKey | YUJCDVGGKFMDRM-HSZRJFAPSA-N |
| XLogP | 4.55 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |