C25H26N4OS — CID 41222045
(6R)-3-benzylsulfanyl-6-[(1S,6S)-4,6-dimethylcyclohex-3-en-1-yl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 41222045) has the molecular formula C25H26N4OS and a molecular weight of 430.58 g/mol. Its IUPAC name is (6R)-3-benzylsulfanyl-6-[(1S,6S)-4,6-dimethylcyclohex-3-en-1-yl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | (6R)-3-benzylsulfanyl-6-[(1S,6S)-4,6-dimethylcyclohex-3-en-1-yl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 41222045 |
| Molecular Formula | C25H26N4OS |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | (6R)-3-benzylsulfanyl-6-[(1S,6S)-4,6-dimethylcyclohex-3-en-1-yl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | CC1=CC[C@H]([C@@H]2Nc3ccccc3-c3nnc(SCc4ccccc4)nc3O2)[C@@H](C)C1 |
| InChI | InChI=1S/C25H26N4OS/c1-16-12-13-19(17(2)14-16)23-26-21-11-7-6-10-20(21)22-24(30-23)27-25(29-28-22)31-15-18-8-4-3-5-9-18/h3-12,17,19,23,26H,13-15H2,1-2H3/t17-,19-,23+/m0/s1 |
| InChIKey | MNRDRZYDKZQMKN-WCAVRKLYSA-N |
| XLogP | 5.95 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|