C21H26N4O2 — CID 58673960
6-(4,6-dimethylcyclohex-3-en-1-yl)-3-propoxy-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 58673960) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 6-(4,6-dimethylcyclohex-3-en-1-yl)-3-propoxy-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | 6-(4,6-dimethylcyclohex-3-en-1-yl)-3-propoxy-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 58673960 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 6-(4,6-dimethylcyclohex-3-en-1-yl)-3-propoxy-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | CCCOc1nnc2c(n1)OC(C1CC=C(C)CC1C)Nc1ccccc1-2 |
| InChI | InChI=1S/C21H26N4O2/c1-4-11-26-21-23-20-18(24-25-21)16-7-5-6-8-17(16)22-19(27-20)15-10-9-13(2)12-14(15)3/h5-9,14-15,19,22H,4,10-12H2,1-3H3 |
| InChIKey | YARHNWOIIJXKJO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|