C30H33ClN4OS — CID 41141014
(6R)-6-[(2S,3R,8aR)-3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]-3-[(2-chlorophenyl)methylsulfanyl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 41141014) has the molecular formula C30H33ClN4OS and a molecular weight of 533.14 g/mol. Its IUPAC name is (6R)-6-[(2S,3R,8aR)-3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]-3-[(2-chlorophenyl)methylsulfanyl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | (6R)-6-[(2S,3R,8aR)-3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]-3-[(2-chlorophenyl)methylsulfanyl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 41141014 |
| Molecular Formula | C30H33ClN4OS |
| Molecular Weight | 533.14 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | (6R)-6-[(2S,3R,8aR)-3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]-3-[(2-chlorophenyl)methylsulfanyl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | C[C@@H]1CC2=CCCC(C)(C)[C@H]2C[C@@H]1[C@@H]1Nc2ccccc2-c2nnc(SCc3ccccc3Cl)nc2O1 |
| InChI | InChI=1S/C30H33ClN4OS/c1-18-15-19-10-8-14-30(2,3)23(19)16-22(18)27-32-25-13-7-5-11-21(25)26-28(36-27)33-29(35-34-26)37-17-20-9-4-6-12-24(20)31/h4-7,9-13,18,22-23,27,32H,8,14-17H2,1-3H3/t18-,22+,23+,27-/m1/s1 |
| InChIKey | OLNKEKWBPYGVQG-IJPNPREFSA-N |
| XLogP | 8.02 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.14 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|