C21H25BrOS — CID 4122511
1-(4-bromophenyl)-3-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]propan-1-one (PubChem CID 4122511) has the molecular formula C21H25BrOS and a molecular weight of 405.40 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]propan-1-one.
| Compound Name | 1-(4-bromophenyl)-3-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]propan-1-one |
|---|---|
| PubChem CID | 4122511 |
| Molecular Formula | C21H25BrOS |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 1-(4-bromophenyl)-3-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]propan-1-one |
| SMILES | Cc1c(C)c(C)c(CSCCC(=O)c2ccc(Br)cc2)c(C)c1C |
| InChI | InChI=1S/C21H25BrOS/c1-13-14(2)16(4)20(17(5)15(13)3)12-24-11-10-21(23)18-6-8-19(22)9-7-18/h6-9H,10-12H2,1-5H3 |
| InChIKey | BRTKSSGZJNJXQN-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|