C19H22N4O4S2 — CID 41235025
(2R)-N-(1,3-benzodioxol-5-ylmethyl)-2-[[5-[cyclopropyl(propanoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide (PubChem CID 41235025) has the molecular formula C19H22N4O4S2 and a molecular weight of 434.54 g/mol. Its IUPAC name is (2R)-N-(1,3-benzodioxol-5-ylmethyl)-2-[[5-[cyclopropyl(propanoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide.
| Compound Name | (2R)-N-(1,3-benzodioxol-5-ylmethyl)-2-[[5-[cyclopropyl(propanoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 41235025 |
| Molecular Formula | C19H22N4O4S2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | (2R)-N-(1,3-benzodioxol-5-ylmethyl)-2-[[5-[cyclopropyl(propanoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
| SMILES | CCC(=O)N(c1nnc(S[C@H](C)C(=O)NCc2ccc3c(c2)OCO3)s1)C1CC1 |
| InChI | InChI=1S/C19H22N4O4S2/c1-3-16(24)23(13-5-6-13)18-21-22-19(29-18)28-11(2)17(25)20-9-12-4-7-14-15(8-12)27-10-26-14/h4,7-8,11,13H,3,5-6,9-10H2,1-2H3,(H,20,25)/t11-/m1/s1 |
| InChIKey | FSQWIJCNSIGGES-LLVKDONJSA-N |
| XLogP | 2.97 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|