C25H24BrClN2O3 — CID 4124586
1-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-N-(3-chloro-4-morpholin-4-ylphenyl)methanimine (PubChem CID 4124586) has the molecular formula C25H24BrClN2O3 and a molecular weight of 515.84 g/mol. Its IUPAC name is 1-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-N-(3-chloro-4-morpholin-4-ylphenyl)methanimine.
| Compound Name | 1-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-N-(3-chloro-4-morpholin-4-ylphenyl)methanimine |
|---|---|
| PubChem CID | 4124586 |
| Molecular Formula | C25H24BrClN2O3 |
| Molecular Weight | 515.84 g/mol |
| Exact Mass | 514.07 |
| IUPAC Name | 1-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-N-(3-chloro-4-morpholin-4-ylphenyl)methanimine |
| SMILES | COc1cc(/C=N/c2ccc(N3CCOCC3)c(Cl)c2)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C25H24BrClN2O3/c1-30-24-14-19(13-21(26)25(24)32-17-18-5-3-2-4-6-18)16-28-20-7-8-23(22(27)15-20)29-9-11-31-12-10-29/h2-8,13-16H,9-12,17H2,1H3/b28-16+ |
| InChIKey | SUGNODUXQUULQE-LQKURTRISA-N |
| XLogP | 6.28 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.84 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|