C19H19N5O4S — CID 41262843
N-[2-(4-nitroanilino)ethyl]-3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)propanamide (PubChem CID 41262843) has the molecular formula C19H19N5O4S and a molecular weight of 413.46 g/mol. Its IUPAC name is N-[2-(4-nitroanilino)ethyl]-3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)propanamide.
| Compound Name | N-[2-(4-nitroanilino)ethyl]-3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)propanamide |
|---|---|
| PubChem CID | 41262843 |
| Molecular Formula | C19H19N5O4S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | N-[2-(4-nitroanilino)ethyl]-3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)propanamide |
| SMILES | O=C(CCn1c(=S)[nH]c2ccccc2c1=O)NCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H19N5O4S/c25-17(21-11-10-20-13-5-7-14(8-6-13)24(27)28)9-12-23-18(26)15-3-1-2-4-16(15)22-19(23)29/h1-8,20H,9-12H2,(H,21,25)(H,22,29) |
| InChIKey | IGEJMIFMBKUYAG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 122.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|