C20H20N4O2S2 — CID 41269601
3-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]-4-pyrrolidin-1-ylbenzamide (PubChem CID 41269601) has the molecular formula C20H20N4O2S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is 3-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]-4-pyrrolidin-1-ylbenzamide.
| Compound Name | 3-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 41269601 |
| Molecular Formula | C20H20N4O2S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 3-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]-4-pyrrolidin-1-ylbenzamide |
| SMILES | NC(=O)c1ccc(N2CCCC2)c(NC(=O)CSc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C20H20N4O2S2/c21-19(26)13-7-8-16(24-9-3-4-10-24)15(11-13)22-18(25)12-27-20-23-14-5-1-2-6-17(14)28-20/h1-2,5-8,11H,3-4,9-10,12H2,(H2,21,26)(H,22,25) |
| InChIKey | ODFDNRRGKCKUKV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |