C30H26ClNO3 — CID 4127539
2-(3-chlorophenyl)-6-ethenyl-7-(4-hydroxy-3,5-dimethylphenyl)-7a-phenyl-4,7-dihydro-3aH-isoindole-1,3-dione (PubChem CID 4127539) has the molecular formula C30H26ClNO3 and a molecular weight of 484.00 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-6-ethenyl-7-(4-hydroxy-3,5-dimethylphenyl)-7a-phenyl-4,7-dihydro-3aH-isoindole-1,3-dione.
| Compound Name | 2-(3-chlorophenyl)-6-ethenyl-7-(4-hydroxy-3,5-dimethylphenyl)-7a-phenyl-4,7-dihydro-3aH-isoindole-1,3-dione |
|---|---|
| PubChem CID | 4127539 |
| Molecular Formula | C30H26ClNO3 |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 2-(3-chlorophenyl)-6-ethenyl-7-(4-hydroxy-3,5-dimethylphenyl)-7a-phenyl-4,7-dihydro-3aH-isoindole-1,3-dione |
| SMILES | C=CC1=CCC2C(=O)N(c3cccc(Cl)c3)C(=O)C2(c2ccccc2)C1c1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C30H26ClNO3/c1-4-20-13-14-25-28(34)32(24-12-8-11-23(31)17-24)29(35)30(25,22-9-6-5-7-10-22)26(20)21-15-18(2)27(33)19(3)16-21/h4-13,15-17,25-26,33H,1,14H2,2-3H3 |
| InChIKey | WMVRRGRKVMMZLP-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|