C30H26ClNO5 — CID 6637278
(3aR,7R,7aS)-2-(3-chlorophenyl)-6-ethenyl-7-(4-hydroxy-3,5-dimethoxyphenyl)-7a-phenyl-4,7-dihydro-3aH-isoindole-1,3-dione (PubChem CID 6637278) has the molecular formula C30H26ClNO5 and a molecular weight of 515.99 g/mol. Its IUPAC name is (3aR,7R,7aS)-2-(3-chlorophenyl)-6-ethenyl-7-(4-hydroxy-3,5-dimethoxyphenyl)-7a-phenyl-4,7-dihydro-3aH-isoindole-1,3-dione.
| Compound Name | (3aR,7R,7aS)-2-(3-chlorophenyl)-6-ethenyl-7-(4-hydroxy-3,5-dimethoxyphenyl)-7a-phenyl-4,7-dihydro-3aH-isoindole-1,3-dione |
|---|---|
| PubChem CID | 6637278 |
| Molecular Formula | C30H26ClNO5 |
| Molecular Weight | 515.99 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | (3aR,7R,7aS)-2-(3-chlorophenyl)-6-ethenyl-7-(4-hydroxy-3,5-dimethoxyphenyl)-7a-phenyl-4,7-dihydro-3aH-isoindole-1,3-dione |
| SMILES | C=CC1=CC[C@H]2C(=O)N(c3cccc(Cl)c3)C(=O)[C@@]2(c2ccccc2)[C@H]1c1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C30H26ClNO5/c1-4-18-13-14-23-28(34)32(22-12-8-11-21(31)17-22)29(35)30(23,20-9-6-5-7-10-20)26(18)19-15-24(36-2)27(33)25(16-19)37-3/h4-13,15-17,23,26,33H,1,14H2,2-3H3/t23-,26+,30+/m0/s1 |
| InChIKey | WECRBLCEVGFIML-JMEFODQWSA-N |
| XLogP | 5.79 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.99 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|