C31H24ClNO4 — CID 4638417
2-(3-chlorophenyl)-6-ethenyl-7-(6-hydroxy-4H-chromen-3-yl)-7a-phenyl-4,7-dihydro-3aH-isoindole-1,3-dione (PubChem CID 4638417) has the molecular formula C31H24ClNO4 and a molecular weight of 509.99 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-6-ethenyl-7-(6-hydroxy-4H-chromen-3-yl)-7a-phenyl-4,7-dihydro-3aH-isoindole-1,3-dione.
| Compound Name | 2-(3-chlorophenyl)-6-ethenyl-7-(6-hydroxy-4H-chromen-3-yl)-7a-phenyl-4,7-dihydro-3aH-isoindole-1,3-dione |
|---|---|
| PubChem CID | 4638417 |
| Molecular Formula | C31H24ClNO4 |
| Molecular Weight | 509.99 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | 2-(3-chlorophenyl)-6-ethenyl-7-(6-hydroxy-4H-chromen-3-yl)-7a-phenyl-4,7-dihydro-3aH-isoindole-1,3-dione |
| SMILES | C=CC1=CCC2C(=O)N(c3cccc(Cl)c3)C(=O)C2(c2ccccc2)C1C1=COc2ccc(O)cc2C1 |
| InChI | InChI=1S/C31H24ClNO4/c1-2-19-11-13-26-29(35)33(24-10-6-9-23(32)17-24)30(36)31(26,22-7-4-3-5-8-22)28(19)21-15-20-16-25(34)12-14-27(20)37-18-21/h2-12,14,16-18,26,28,34H,1,13,15H2 |
| InChIKey | ONVXKSWXYRSIHV-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.99 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|