C25H14Cl2F5NO4 — CID 6637146
(3aS,4R,7aR)-3a,7a-dichloro-5-ethenyl-4-(6-hydroxy-4H-chromen-3-yl)-2-(2,3,4,5,6-pentafluorophenyl)-4,7-dihydroisoindole-1,3-dione (PubChem CID 6637146) has the molecular formula C25H14Cl2F5NO4 and a molecular weight of 558.29 g/mol. Its IUPAC name is (3aS,4R,7aR)-3a,7a-dichloro-5-ethenyl-4-(6-hydroxy-4H-chromen-3-yl)-2-(2,3,4,5,6-pentafluorophenyl)-4,7-dihydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-3a,7a-dichloro-5-ethenyl-4-(6-hydroxy-4H-chromen-3-yl)-2-(2,3,4,5,6-pentafluorophenyl)-4,7-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 6637146 |
| Molecular Formula | C25H14Cl2F5NO4 |
| Molecular Weight | 558.29 g/mol |
| Exact Mass | 557.02 |
| IUPAC Name | (3aS,4R,7aR)-3a,7a-dichloro-5-ethenyl-4-(6-hydroxy-4H-chromen-3-yl)-2-(2,3,4,5,6-pentafluorophenyl)-4,7-dihydroisoindole-1,3-dione |
| SMILES | C=CC1=CC[C@@]2(Cl)C(=O)N(c3c(F)c(F)c(F)c(F)c3F)C(=O)[C@@]2(Cl)[C@H]1C1=COc2ccc(O)cc2C1 |
| InChI | InChI=1S/C25H14Cl2F5NO4/c1-2-10-5-6-24(26)22(35)33(21-19(31)17(29)16(28)18(30)20(21)32)23(36)25(24,27)15(10)12-7-11-8-13(34)3-4-14(11)37-9-12/h2-5,8-9,15,34H,1,6-7H2/t15-,24-,25+/m1/s1 |
| InChIKey | CMOHHMPCNCSAQL-HGPNYFESSA-N |
| XLogP | 5.57 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.29 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|