C22H12Cl2F5NO3 — CID 6637058
(3aS,4R,7aR)-3a,7a-dichloro-5-ethenyl-4-(4-hydroxyphenyl)-2-(2,3,4,5,6-pentafluorophenyl)-4,7-dihydroisoindole-1,3-dione (PubChem CID 6637058) has the molecular formula C22H12Cl2F5NO3 and a molecular weight of 504.24 g/mol. Its IUPAC name is (3aS,4R,7aR)-3a,7a-dichloro-5-ethenyl-4-(4-hydroxyphenyl)-2-(2,3,4,5,6-pentafluorophenyl)-4,7-dihydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-3a,7a-dichloro-5-ethenyl-4-(4-hydroxyphenyl)-2-(2,3,4,5,6-pentafluorophenyl)-4,7-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 6637058 |
| Molecular Formula | C22H12Cl2F5NO3 |
| Molecular Weight | 504.24 g/mol |
| Exact Mass | 503.01 |
| IUPAC Name | (3aS,4R,7aR)-3a,7a-dichloro-5-ethenyl-4-(4-hydroxyphenyl)-2-(2,3,4,5,6-pentafluorophenyl)-4,7-dihydroisoindole-1,3-dione |
| SMILES | C=CC1=CC[C@@]2(Cl)C(=O)N(c3c(F)c(F)c(F)c(F)c3F)C(=O)[C@@]2(Cl)[C@H]1c1ccc(O)cc1 |
| InChI | InChI=1S/C22H12Cl2F5NO3/c1-2-9-7-8-21(23)19(32)30(18-16(28)14(26)13(25)15(27)17(18)29)20(33)22(21,24)12(9)10-3-5-11(31)6-4-10/h2-7,12,31H,1,8H2/t12-,21-,22+/m1/s1 |
| InChIKey | ONQVHWYIPDITKL-WLERDACDSA-N |
| XLogP | 5.22 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.24 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|