C17H14BrCl2NO3 — CID 6636987
(3aS,4R,7aR)-2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-(2-hydroxyphenyl)-4,7-dihydroisoindole-1,3-dione (PubChem CID 6636987) has the molecular formula C17H14BrCl2NO3 and a molecular weight of 431.11 g/mol. Its IUPAC name is (3aS,4R,7aR)-2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-(2-hydroxyphenyl)-4,7-dihydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-(2-hydroxyphenyl)-4,7-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 6636987 |
| Molecular Formula | C17H14BrCl2NO3 |
| Molecular Weight | 431.11 g/mol |
| Exact Mass | 428.95 |
| IUPAC Name | (3aS,4R,7aR)-2-(bromomethyl)-3a,7a-dichloro-5-ethenyl-4-(2-hydroxyphenyl)-4,7-dihydroisoindole-1,3-dione |
| SMILES | C=CC1=CC[C@@]2(Cl)C(=O)N(CBr)C(=O)[C@@]2(Cl)[C@H]1c1ccccc1O |
| InChI | InChI=1S/C17H14BrCl2NO3/c1-2-10-7-8-16(19)14(23)21(9-18)15(24)17(16,20)13(10)11-5-3-4-6-12(11)22/h2-7,13,22H,1,8-9H2/t13-,16-,17+/m1/s1 |
| InChIKey | BUDOIQHYOKOMJA-XYPHTWIQSA-N |
| XLogP | 3.67 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.11 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|