C29H22Cl2FNO4 — CID 6637041
(3aS,4R,7aR)-3a,7a-dichloro-5-ethenyl-2-(4-fluorophenyl)-4-(2-hydroxy-4-phenylmethoxyphenyl)-4,7-dihydroisoindole-1,3-dione (PubChem CID 6637041) has the molecular formula C29H22Cl2FNO4 and a molecular weight of 538.40 g/mol. Its IUPAC name is (3aS,4R,7aR)-3a,7a-dichloro-5-ethenyl-2-(4-fluorophenyl)-4-(2-hydroxy-4-phenylmethoxyphenyl)-4,7-dihydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-3a,7a-dichloro-5-ethenyl-2-(4-fluorophenyl)-4-(2-hydroxy-4-phenylmethoxyphenyl)-4,7-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 6637041 |
| Molecular Formula | C29H22Cl2FNO4 |
| Molecular Weight | 538.40 g/mol |
| Exact Mass | 537.09 |
| IUPAC Name | (3aS,4R,7aR)-3a,7a-dichloro-5-ethenyl-2-(4-fluorophenyl)-4-(2-hydroxy-4-phenylmethoxyphenyl)-4,7-dihydroisoindole-1,3-dione |
| SMILES | C=CC1=CC[C@@]2(Cl)C(=O)N(c3ccc(F)cc3)C(=O)[C@@]2(Cl)[C@H]1c1ccc(OCc2ccccc2)cc1O |
| InChI | InChI=1S/C29H22Cl2FNO4/c1-2-19-14-15-28(30)26(35)33(21-10-8-20(32)9-11-21)27(36)29(28,31)25(19)23-13-12-22(16-24(23)34)37-17-18-6-4-3-5-7-18/h2-14,16,25,34H,1,15,17H2/t25-,28-,29+/m1/s1 |
| InChIKey | OJWGRFQHJFXJPC-ZJGIAAPESA-N |
| XLogP | 6.24 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.40 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|