C23H18Cl2FNO4 — CID 6637005
(3aS,4R,7aR)-3a,7a-dichloro-5-ethenyl-2-(4-fluorophenyl)-4-(2-hydroxy-4-methoxyphenyl)-4,7-dihydroisoindole-1,3-dione (PubChem CID 6637005) has the molecular formula C23H18Cl2FNO4 and a molecular weight of 462.30 g/mol. Its IUPAC name is (3aS,4R,7aR)-3a,7a-dichloro-5-ethenyl-2-(4-fluorophenyl)-4-(2-hydroxy-4-methoxyphenyl)-4,7-dihydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-3a,7a-dichloro-5-ethenyl-2-(4-fluorophenyl)-4-(2-hydroxy-4-methoxyphenyl)-4,7-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 6637005 |
| Molecular Formula | C23H18Cl2FNO4 |
| Molecular Weight | 462.30 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | (3aS,4R,7aR)-3a,7a-dichloro-5-ethenyl-2-(4-fluorophenyl)-4-(2-hydroxy-4-methoxyphenyl)-4,7-dihydroisoindole-1,3-dione |
| SMILES | C=CC1=CC[C@@]2(Cl)C(=O)N(c3ccc(F)cc3)C(=O)[C@@]2(Cl)[C@H]1c1ccc(OC)cc1O |
| InChI | InChI=1S/C23H18Cl2FNO4/c1-3-13-10-11-22(24)20(29)27(15-6-4-14(26)5-7-15)21(30)23(22,25)19(13)17-9-8-16(31-2)12-18(17)28/h3-10,12,19,28H,1,11H2,2H3/t19-,22-,23+/m1/s1 |
| InChIKey | RZRQQKMPSKXSGE-PTUXOGIPSA-N |
| XLogP | 4.67 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.30 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|