C23H17BrCl2FNO4 — CID 4231362
4-(5-bromo-2-hydroxy-3-methoxyphenyl)-3a,7a-dichloro-5-ethenyl-2-(4-fluorophenyl)-4,7-dihydroisoindole-1,3-dione (PubChem CID 4231362) has the molecular formula C23H17BrCl2FNO4 and a molecular weight of 541.20 g/mol. Its IUPAC name is 4-(5-bromo-2-hydroxy-3-methoxyphenyl)-3a,7a-dichloro-5-ethenyl-2-(4-fluorophenyl)-4,7-dihydroisoindole-1,3-dione.
| Compound Name | 4-(5-bromo-2-hydroxy-3-methoxyphenyl)-3a,7a-dichloro-5-ethenyl-2-(4-fluorophenyl)-4,7-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 4231362 |
| Molecular Formula | C23H17BrCl2FNO4 |
| Molecular Weight | 541.20 g/mol |
| Exact Mass | 538.97 |
| IUPAC Name | 4-(5-bromo-2-hydroxy-3-methoxyphenyl)-3a,7a-dichloro-5-ethenyl-2-(4-fluorophenyl)-4,7-dihydroisoindole-1,3-dione |
| SMILES | C=CC1=CCC2(Cl)C(=O)N(c3ccc(F)cc3)C(=O)C2(Cl)C1c1cc(Br)cc(OC)c1O |
| InChI | InChI=1S/C23H17BrCl2FNO4/c1-3-12-8-9-22(25)20(30)28(15-6-4-14(27)5-7-15)21(31)23(22,26)18(12)16-10-13(24)11-17(32-2)19(16)29/h3-8,10-11,18,29H,1,9H2,2H3 |
| InChIKey | MAXACOVDTMIPOD-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.20 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|